C10H16FN3O — CID 103867388
2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]butan-1-ol (PubChem CID 103867388) has the molecular formula C10H16FN3O and a molecular weight of 213.26 g/mol. Its IUPAC name is 2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]butan-1-ol.
| Compound Name | 2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]butan-1-ol |
|---|---|
| PubChem CID | 103867388 |
| Molecular Formula | C10H16FN3O |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]butan-1-ol |
| SMILES | CCc1ncnc(NC(CC)CO)c1F |
| InChI | InChI=1S/C10H16FN3O/c1-3-7(5-15)14-10-9(11)8(4-2)12-6-13-10/h6-7,15H,3-5H2,1-2H3,(H,12,13,14) |
| InChIKey | BUUOHDJNCSSAEN-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |