C12H20FN3 — CID 103879965
6-ethyl-5-fluoro-N-(2-methylpentan-3-yl)pyrimidin-4-amine (PubChem CID 103879965) has the molecular formula C12H20FN3 and a molecular weight of 225.31 g/mol. Its IUPAC name is 6-ethyl-5-fluoro-N-(2-methylpentan-3-yl)pyrimidin-4-amine.
| Compound Name | 6-ethyl-5-fluoro-N-(2-methylpentan-3-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 103879965 |
| Molecular Formula | C12H20FN3 |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 6-ethyl-5-fluoro-N-(2-methylpentan-3-yl)pyrimidin-4-amine |
| SMILES | CCc1ncnc(NC(CC)C(C)C)c1F |
| InChI | InChI=1S/C12H20FN3/c1-5-9(8(3)4)16-12-11(13)10(6-2)14-7-15-12/h7-9H,5-6H2,1-4H3,(H,14,15,16) |
| InChIKey | UWLZHACYYQQFGT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |