C14H20N2O5 — CID 103869710
2-[[(2R)-2-amino-3-(4-hydroxyphenyl)propanoyl]-(2-methoxyethyl)amino]acetic acid (PubChem CID 103869710) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-[[(2R)-2-amino-3-(4-hydroxyphenyl)propanoyl]-(2-methoxyethyl)amino]acetic acid.
| Compound Name | 2-[[(2R)-2-amino-3-(4-hydroxyphenyl)propanoyl]-(2-methoxyethyl)amino]acetic acid |
|---|---|
| PubChem CID | 103869710 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 2-[[(2R)-2-amino-3-(4-hydroxyphenyl)propanoyl]-(2-methoxyethyl)amino]acetic acid |
| SMILES | COCCN(CC(=O)O)C(=O)[C@H](N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C14H20N2O5/c1-21-7-6-16(9-13(18)19)14(20)12(15)8-10-2-4-11(17)5-3-10/h2-5,12,17H,6-9,15H2,1H3,(H,18,19)/t12-/m1/s1 |
| InChIKey | ROSZSAYRKMEXEC-GFCCVEGCSA-N |
| XLogP | -0.18 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |