C13H18N4O4 — CID 104905118
(2R)-2-amino-N,N-bis(2-amino-2-oxoethyl)-3-(4-hydroxyphenyl)propanamide (PubChem CID 104905118) has the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is (2R)-2-amino-N,N-bis(2-amino-2-oxoethyl)-3-(4-hydroxyphenyl)propanamide.
| Compound Name | (2R)-2-amino-N,N-bis(2-amino-2-oxoethyl)-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 104905118 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (2R)-2-amino-N,N-bis(2-amino-2-oxoethyl)-3-(4-hydroxyphenyl)propanamide |
| SMILES | NC(=O)CN(CC(N)=O)C(=O)[C@H](N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C13H18N4O4/c14-10(5-8-1-3-9(18)4-2-8)13(21)17(6-11(15)19)7-12(16)20/h1-4,10,18H,5-7,14H2,(H2,15,19)(H2,16,20)/t10-/m1/s1 |
| InChIKey | CBFCBRJJELAGLM-SNVBAGLBSA-N |
| XLogP | -1.94 |
| TPSA | 152.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |