C13H14N4O2 — CID 76892169
2-amino-N,N-bis(cyanomethyl)-3-(4-hydroxyphenyl)propanamide (PubChem CID 76892169) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is 2-amino-N,N-bis(cyanomethyl)-3-(4-hydroxyphenyl)propanamide.
| Compound Name | 2-amino-N,N-bis(cyanomethyl)-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 76892169 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 2-amino-N,N-bis(cyanomethyl)-3-(4-hydroxyphenyl)propanamide |
| SMILES | N#CCN(CC#N)C(=O)C(N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C13H14N4O2/c14-5-7-17(8-6-15)13(19)12(16)9-10-1-3-11(18)4-2-10/h1-4,12,18H,7-9,16H2 |
| InChIKey | HAUXKMPUMPREMK-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|