C14H22N2O3 — CID 61163358
(2S)-2-amino-N-(2-hydroxyethyl)-3-(4-hydroxyphenyl)-N-propylpropanamide (PubChem CID 61163358) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is (2S)-2-amino-N-(2-hydroxyethyl)-3-(4-hydroxyphenyl)-N-propylpropanamide.
| Compound Name | (2S)-2-amino-N-(2-hydroxyethyl)-3-(4-hydroxyphenyl)-N-propylpropanamide |
|---|---|
| PubChem CID | 61163358 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | (2S)-2-amino-N-(2-hydroxyethyl)-3-(4-hydroxyphenyl)-N-propylpropanamide |
| SMILES | CCCN(CCO)C(=O)[C@@H](N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C14H22N2O3/c1-2-7-16(8-9-17)14(19)13(15)10-11-3-5-12(18)6-4-11/h3-6,13,17-18H,2,7-10,15H2,1H3/t13-/m0/s1 |
| InChIKey | YXAIFBMTXDQIST-ZDUSSCGKSA-N |
| XLogP | 0.49 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |