C12H15FN2O3 — CID 103871049
2-[(4-amino-2-fluorobenzoyl)-methylamino]butanoic acid (PubChem CID 103871049) has the molecular formula C12H15FN2O3 and a molecular weight of 254.26 g/mol. Its IUPAC name is 2-[(4-amino-2-fluorobenzoyl)-methylamino]butanoic acid.
| Compound Name | 2-[(4-amino-2-fluorobenzoyl)-methylamino]butanoic acid |
|---|---|
| PubChem CID | 103871049 |
| Molecular Formula | C12H15FN2O3 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-[(4-amino-2-fluorobenzoyl)-methylamino]butanoic acid |
| SMILES | CCC(C(=O)O)N(C)C(=O)c1ccc(N)cc1F |
| InChI | InChI=1S/C12H15FN2O3/c1-3-10(12(17)18)15(2)11(16)8-5-4-7(14)6-9(8)13/h4-6,10H,3,14H2,1-2H3,(H,17,18) |
| InChIKey | QBVFBIZBCSCGKU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|