C12H12F3NO3 — CID 65101524
2-[methyl-(2,4,6-trifluorobenzoyl)amino]butanoic acid (PubChem CID 65101524) has the molecular formula C12H12F3NO3 and a molecular weight of 275.23 g/mol. Its IUPAC name is 2-[methyl-(2,4,6-trifluorobenzoyl)amino]butanoic acid.
| Compound Name | 2-[methyl-(2,4,6-trifluorobenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 65101524 |
| Molecular Formula | C12H12F3NO3 |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-[methyl-(2,4,6-trifluorobenzoyl)amino]butanoic acid |
| SMILES | CCC(C(=O)O)N(C)C(=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C12H12F3NO3/c1-3-9(12(18)19)16(2)11(17)10-7(14)4-6(13)5-8(10)15/h4-5,9H,3H2,1-2H3,(H,18,19) |
| InChIKey | LNAZFMZBCOQHAE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |