C11H12F2N2O4 — CID 115507434
2-(3,5-difluoro-N-methyl-2-nitroanilino)butanoic acid (PubChem CID 115507434) has the molecular formula C11H12F2N2O4 and a molecular weight of 274.22 g/mol. Its IUPAC name is 2-(3,5-difluoro-N-methyl-2-nitroanilino)butanoic acid.
| Compound Name | 2-(3,5-difluoro-N-methyl-2-nitroanilino)butanoic acid |
|---|---|
| PubChem CID | 115507434 |
| Molecular Formula | C11H12F2N2O4 |
| Molecular Weight | 274.22 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-(3,5-difluoro-N-methyl-2-nitroanilino)butanoic acid |
| SMILES | CCC(C(=O)O)N(C)c1cc(F)cc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12F2N2O4/c1-3-8(11(16)17)14(2)9-5-6(12)4-7(13)10(9)15(18)19/h4-5,8H,3H2,1-2H3,(H,16,17) |
| InChIKey | ZZHVQSLMNWRXMC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|