C9H8F2N2O3 — CID 175765193
N-(3,5-difluoro-2-nitrophenyl)-N-(trideuteriomethyl)acetamide (PubChem CID 175765193) has the molecular formula C9H8F2N2O3 and a molecular weight of 233.19 g/mol. Its IUPAC name is N-(3,5-difluoro-2-nitrophenyl)-N-(trideuteriomethyl)acetamide.
| Compound Name | N-(3,5-difluoro-2-nitrophenyl)-N-(trideuteriomethyl)acetamide |
|---|---|
| PubChem CID | 175765193 |
| Molecular Formula | C9H8F2N2O3 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | N-(3,5-difluoro-2-nitrophenyl)-N-(trideuteriomethyl)acetamide |
| SMILES | [2H]C([2H])([2H])N(C(C)=O)c1cc(F)cc(F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H8F2N2O3/c1-5(14)12(2)8-4-6(10)3-7(11)9(8)13(15)16/h3-4H,1-2H3/i2D3 |
| InChIKey | NEKJLDIQLBGHPP-BMSJAHLVSA-N |
| XLogP | 1.86 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|