C12H15F2N3O2 — CID 116653377
1-cyclopropyl-N-(3,5-difluoro-2-nitrophenyl)-N-methylethane-1,2-diamine (PubChem CID 116653377) has the molecular formula C12H15F2N3O2 and a molecular weight of 271.27 g/mol. Its IUPAC name is 1-cyclopropyl-N-(3,5-difluoro-2-nitrophenyl)-N-methylethane-1,2-diamine.
| Compound Name | 1-cyclopropyl-N-(3,5-difluoro-2-nitrophenyl)-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 116653377 |
| Molecular Formula | C12H15F2N3O2 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 1-cyclopropyl-N-(3,5-difluoro-2-nitrophenyl)-N-methylethane-1,2-diamine |
| SMILES | CN(c1cc(F)cc(F)c1[N+](=O)[O-])C(CN)C1CC1 |
| InChI | InChI=1S/C12H15F2N3O2/c1-16(11(6-15)7-2-3-7)10-5-8(13)4-9(14)12(10)17(18)19/h4-5,7,11H,2-3,6,15H2,1H3 |
| InChIKey | OTUOPWMNPFJWOU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|