C14H13BrN2O3 — CID 103874074
6-bromo-N-(3,5-dimethoxyphenyl)pyridine-2-carboxamide (PubChem CID 103874074) has the molecular formula C14H13BrN2O3 and a molecular weight of 337.17 g/mol. Its IUPAC name is 6-bromo-N-(3,5-dimethoxyphenyl)pyridine-2-carboxamide.
| Compound Name | 6-bromo-N-(3,5-dimethoxyphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 103874074 |
| Molecular Formula | C14H13BrN2O3 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 6-bromo-N-(3,5-dimethoxyphenyl)pyridine-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2cccc(Br)n2)cc(OC)c1 |
| InChI | InChI=1S/C14H13BrN2O3/c1-19-10-6-9(7-11(8-10)20-2)16-14(18)12-4-3-5-13(15)17-12/h3-8H,1-2H3,(H,16,18) |
| InChIKey | YMNORAZRKCUWER-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|