C15H13BrF2N2O — CID 103874208
6-bromo-N-[1-(3,4-difluorophenyl)ethyl]-N-methylpyridine-2-carboxamide (PubChem CID 103874208) has the molecular formula C15H13BrF2N2O and a molecular weight of 355.18 g/mol. Its IUPAC name is 6-bromo-N-[1-(3,4-difluorophenyl)ethyl]-N-methylpyridine-2-carboxamide.
| Compound Name | 6-bromo-N-[1-(3,4-difluorophenyl)ethyl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 103874208 |
| Molecular Formula | C15H13BrF2N2O |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 6-bromo-N-[1-(3,4-difluorophenyl)ethyl]-N-methylpyridine-2-carboxamide |
| SMILES | CC(c1ccc(F)c(F)c1)N(C)C(=O)c1cccc(Br)n1 |
| InChI | InChI=1S/C15H13BrF2N2O/c1-9(10-6-7-11(17)12(18)8-10)20(2)15(21)13-4-3-5-14(16)19-13/h3-9H,1-2H3 |
| InChIKey | HUDPRJCNXULOFA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|