C19H15ClF2N2O — CID 55731326
2-chloro-N-[1-(3,4-difluorophenyl)ethyl]-N-methylquinoline-6-carboxamide (PubChem CID 55731326) has the molecular formula C19H15ClF2N2O and a molecular weight of 360.79 g/mol. Its IUPAC name is 2-chloro-N-[1-(3,4-difluorophenyl)ethyl]-N-methylquinoline-6-carboxamide.
| Compound Name | 2-chloro-N-[1-(3,4-difluorophenyl)ethyl]-N-methylquinoline-6-carboxamide |
|---|---|
| PubChem CID | 55731326 |
| Molecular Formula | C19H15ClF2N2O |
| Molecular Weight | 360.79 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 2-chloro-N-[1-(3,4-difluorophenyl)ethyl]-N-methylquinoline-6-carboxamide |
| SMILES | CC(c1ccc(F)c(F)c1)N(C)C(=O)c1ccc2nc(Cl)ccc2c1 |
| InChI | InChI=1S/C19H15ClF2N2O/c1-11(12-3-6-15(21)16(22)10-12)24(2)19(25)14-4-7-17-13(9-14)5-8-18(20)23-17/h3-11H,1-2H3 |
| InChIKey | MBRFGBFQYAAUNT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.79 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|