C18H13ClF2N2O — CID 55730341
2-chloro-N-[(2,4-difluorophenyl)methyl]-N-methylquinoline-6-carboxamide (PubChem CID 55730341) has the molecular formula C18H13ClF2N2O and a molecular weight of 346.76 g/mol. Its IUPAC name is 2-chloro-N-[(2,4-difluorophenyl)methyl]-N-methylquinoline-6-carboxamide.
| Compound Name | 2-chloro-N-[(2,4-difluorophenyl)methyl]-N-methylquinoline-6-carboxamide |
|---|---|
| PubChem CID | 55730341 |
| Molecular Formula | C18H13ClF2N2O |
| Molecular Weight | 346.76 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 2-chloro-N-[(2,4-difluorophenyl)methyl]-N-methylquinoline-6-carboxamide |
| SMILES | CN(Cc1ccc(F)cc1F)C(=O)c1ccc2nc(Cl)ccc2c1 |
| InChI | InChI=1S/C18H13ClF2N2O/c1-23(10-13-2-5-14(20)9-15(13)21)18(24)12-3-6-16-11(8-12)4-7-17(19)22-16/h2-9H,10H2,1H3 |
| InChIKey | IDYZRCIBPBENRA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.76 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|