C25H44O3Si — CID 10387441
[(2E,6Z,10E)-13-(3,3-dimethyloxiran-2-yl)-3,11-dimethyl-7-(trimethylsilylmethyl)trideca-2,6,10-trienyl] acetate (PubChem CID 10387441) has the molecular formula C25H44O3Si and a molecular weight of 420.71 g/mol. Its IUPAC name is [(2E,6Z,10E)-13-(3,3-dimethyloxiran-2-yl)-3,11-dimethyl-7-(trimethylsilylmethyl)trideca-2,6,10-trienyl] acetate.
| Compound Name | [(2E,6Z,10E)-13-(3,3-dimethyloxiran-2-yl)-3,11-dimethyl-7-(trimethylsilylmethyl)trideca-2,6,10-trienyl] acetate |
|---|---|
| PubChem CID | 10387441 |
| Molecular Formula | C25H44O3Si |
| Molecular Weight | 420.71 g/mol |
| Exact Mass | 420.31 |
| IUPAC Name | [(2E,6Z,10E)-13-(3,3-dimethyloxiran-2-yl)-3,11-dimethyl-7-(trimethylsilylmethyl)trideca-2,6,10-trienyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC/C=C(/CC/C=C(\C)CCC1OC1(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C25H44O3Si/c1-20(15-16-24-25(4,5)28-24)11-9-13-23(19-29(6,7)8)14-10-12-21(2)17-18-27-22(3)26/h11,14,17,24H,9-10,12-13,15-16,18-19H2,1-8H3/b20-11+,21-17+,23-14- |
| InChIKey | JLXGEZDBGXZFKT-IAQWPVSLSA-N |
| XLogP | 7.22 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.71 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|