C8H15F3N2O3 — CID 103876113
1-(3-hydroxy-4-methoxybutyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 103876113) has the molecular formula C8H15F3N2O3 and a molecular weight of 244.21 g/mol. Its IUPAC name is 1-(3-hydroxy-4-methoxybutyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(3-hydroxy-4-methoxybutyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 103876113 |
| Molecular Formula | C8H15F3N2O3 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 1-(3-hydroxy-4-methoxybutyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | COCC(O)CCNC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H15F3N2O3/c1-16-4-6(14)2-3-12-7(15)13-5-8(9,10)11/h6,14H,2-5H2,1H3,(H2,12,13,15) |
| InChIKey | VSRKOXHLHAWSKG-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |