C24H24FNO5 — CID 10387690
5-[(2,3-dimethoxyphenyl)methyl-[(2-fluorophenyl)methyl]amino]-2-methoxybenzoic acid (PubChem CID 10387690) has the molecular formula C24H24FNO5 and a molecular weight of 425.46 g/mol. Its IUPAC name is 5-[(2,3-dimethoxyphenyl)methyl-[(2-fluorophenyl)methyl]amino]-2-methoxybenzoic acid.
| Compound Name | 5-[(2,3-dimethoxyphenyl)methyl-[(2-fluorophenyl)methyl]amino]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 10387690 |
| Molecular Formula | C24H24FNO5 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 5-[(2,3-dimethoxyphenyl)methyl-[(2-fluorophenyl)methyl]amino]-2-methoxybenzoic acid |
| SMILES | COc1ccc(N(Cc2ccccc2F)Cc2cccc(OC)c2OC)cc1C(=O)O |
| InChI | InChI=1S/C24H24FNO5/c1-29-21-12-11-18(13-19(21)24(27)28)26(14-16-7-4-5-9-20(16)25)15-17-8-6-10-22(30-2)23(17)31-3/h4-13H,14-15H2,1-3H3,(H,27,28) |
| InChIKey | SACXADYDGGEDDB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|