C12H14BrN5O2 — CID 103877986
3-bromo-5-nitro-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]pyridin-4-amine (PubChem CID 103877986) has the molecular formula C12H14BrN5O2 and a molecular weight of 340.18 g/mol. Its IUPAC name is 3-bromo-5-nitro-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]pyridin-4-amine.
| Compound Name | 3-bromo-5-nitro-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 103877986 |
| Molecular Formula | C12H14BrN5O2 |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 3-bromo-5-nitro-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]pyridin-4-amine |
| SMILES | Cc1nn(C)c(C)c1CNc1c(Br)cncc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14BrN5O2/c1-7-9(8(2)17(3)16-7)4-15-12-10(13)5-14-6-11(12)18(19)20/h5-6H,4H2,1-3H3,(H,14,15) |
| InChIKey | TUMDFUMDXXEXQJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|