C10H9BrN4O2S — CID 114128057
3-bromo-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-5-nitropyridin-4-amine (PubChem CID 114128057) has the molecular formula C10H9BrN4O2S and a molecular weight of 329.18 g/mol. Its IUPAC name is 3-bromo-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-5-nitropyridin-4-amine.
| Compound Name | 3-bromo-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-5-nitropyridin-4-amine |
|---|---|
| PubChem CID | 114128057 |
| Molecular Formula | C10H9BrN4O2S |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 327.96 |
| IUPAC Name | 3-bromo-N-[(5-methyl-1,3-thiazol-2-yl)methyl]-5-nitropyridin-4-amine |
| SMILES | Cc1cnc(CNc2c(Br)cncc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C10H9BrN4O2S/c1-6-2-13-9(18-6)5-14-10-7(11)3-12-4-8(10)15(16)17/h2-4H,5H2,1H3,(H,12,14) |
| InChIKey | LTCRQCGJMUTZLU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|