C13H19FN4O — CID 103879852
2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]-1-piperidin-1-ylethanone (PubChem CID 103879852) has the molecular formula C13H19FN4O and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]-1-piperidin-1-ylethanone.
| Compound Name | 2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 103879852 |
| Molecular Formula | C13H19FN4O |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]-1-piperidin-1-ylethanone |
| SMILES | CCc1ncnc(NCC(=O)N2CCCCC2)c1F |
| InChI | InChI=1S/C13H19FN4O/c1-2-10-12(14)13(17-9-16-10)15-8-11(19)18-6-4-3-5-7-18/h9H,2-8H2,1H3,(H,15,16,17) |
| InChIKey | JROCMIOIIGFTAO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |