C11H14N2O2 — CID 103881856
5-[[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]furan-2-carbonitrile (PubChem CID 103881856) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 5-[[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]furan-2-carbonitrile.
| Compound Name | 5-[[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]furan-2-carbonitrile |
|---|---|
| PubChem CID | 103881856 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 5-[[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]furan-2-carbonitrile |
| SMILES | N#Cc1ccc(CN2CCC[C@@H]2CO)o1 |
| InChI | InChI=1S/C11H14N2O2/c12-6-10-3-4-11(15-10)7-13-5-1-2-9(13)8-14/h3-4,9,14H,1-2,5,7-8H2/t9-/m1/s1 |
| InChIKey | MBMIEQKXRLAAEH-SECBINFHSA-N |
| XLogP | 1.11 |
| TPSA | 60.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |