C14H23NO2 — CID 50981707
[5-[(2-butylpyrrolidin-1-yl)methyl]furan-2-yl]methanol (PubChem CID 50981707) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is [5-[(2-butylpyrrolidin-1-yl)methyl]furan-2-yl]methanol.
| Compound Name | [5-[(2-butylpyrrolidin-1-yl)methyl]furan-2-yl]methanol |
|---|---|
| PubChem CID | 50981707 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | [5-[(2-butylpyrrolidin-1-yl)methyl]furan-2-yl]methanol |
| SMILES | CCCCC1CCCN1Cc1ccc(CO)o1 |
| InChI | InChI=1S/C14H23NO2/c1-2-3-5-12-6-4-9-15(12)10-13-7-8-14(11-16)17-13/h7-8,12,16H,2-6,9-11H2,1H3 |
| InChIKey | YIBCFNLRWRRYLY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |