C20H20ClN3O2S — CID 10388412
7-(4-chlorophenyl)sulfonyl-1-(1,4-diazepan-1-yl)isoquinoline (PubChem CID 10388412) has the molecular formula C20H20ClN3O2S and a molecular weight of 401.92 g/mol. Its IUPAC name is 7-(4-chlorophenyl)sulfonyl-1-(1,4-diazepan-1-yl)isoquinoline.
| Compound Name | 7-(4-chlorophenyl)sulfonyl-1-(1,4-diazepan-1-yl)isoquinoline |
|---|---|
| PubChem CID | 10388412 |
| Molecular Formula | C20H20ClN3O2S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 7-(4-chlorophenyl)sulfonyl-1-(1,4-diazepan-1-yl)isoquinoline |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)c1ccc2ccnc(N3CCCNCC3)c2c1 |
| InChI | InChI=1S/C20H20ClN3O2S/c21-16-3-6-17(7-4-16)27(25,26)18-5-2-15-8-10-23-20(19(15)14-18)24-12-1-9-22-11-13-24/h2-8,10,14,22H,1,9,11-13H2 |
| InChIKey | SFFNHGMZCCGSLH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |