C14H10Br2N2O3 — CID 103885202
2,4-dibromo-N-(2-methyl-5-nitrophenyl)benzamide (PubChem CID 103885202) has the molecular formula C14H10Br2N2O3 and a molecular weight of 414.05 g/mol. Its IUPAC name is 2,4-dibromo-N-(2-methyl-5-nitrophenyl)benzamide.
| Compound Name | 2,4-dibromo-N-(2-methyl-5-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 103885202 |
| Molecular Formula | C14H10Br2N2O3 |
| Molecular Weight | 414.05 g/mol |
| Exact Mass | 411.91 |
| IUPAC Name | 2,4-dibromo-N-(2-methyl-5-nitrophenyl)benzamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H10Br2N2O3/c1-8-2-4-10(18(20)21)7-13(8)17-14(19)11-5-3-9(15)6-12(11)16/h2-7H,1H3,(H,17,19) |
| InChIKey | ANKGEXKXACVSDM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.05 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|