C14H13BrN2O4 — CID 55606742
4-bromo-2,5-dimethyl-N-(2-methyl-5-nitrophenyl)furan-3-carboxamide (PubChem CID 55606742) has the molecular formula C14H13BrN2O4 and a molecular weight of 353.17 g/mol. Its IUPAC name is 4-bromo-2,5-dimethyl-N-(2-methyl-5-nitrophenyl)furan-3-carboxamide.
| Compound Name | 4-bromo-2,5-dimethyl-N-(2-methyl-5-nitrophenyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 55606742 |
| Molecular Formula | C14H13BrN2O4 |
| Molecular Weight | 353.17 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 4-bromo-2,5-dimethyl-N-(2-methyl-5-nitrophenyl)furan-3-carboxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)c1c(C)oc(C)c1Br |
| InChI | InChI=1S/C14H13BrN2O4/c1-7-4-5-10(17(19)20)6-11(7)16-14(18)12-8(2)21-9(3)13(12)15/h4-6H,1-3H3,(H,16,18) |
| InChIKey | KMRBGVPXCTWCSM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 85.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.17 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|