C14H15FN2O2 — CID 103886139
methyl 1-[(3-cyano-2-fluorophenyl)methyl]pyrrolidine-2-carboxylate (PubChem CID 103886139) has the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. Its IUPAC name is methyl 1-[(3-cyano-2-fluorophenyl)methyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-[(3-cyano-2-fluorophenyl)methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 103886139 |
| Molecular Formula | C14H15FN2O2 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | methyl 1-[(3-cyano-2-fluorophenyl)methyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1Cc1cccc(C#N)c1F |
| InChI | InChI=1S/C14H15FN2O2/c1-19-14(18)12-6-3-7-17(12)9-11-5-2-4-10(8-16)13(11)15/h2,4-5,12H,3,6-7,9H2,1H3 |
| InChIKey | QDTOXDIWSRUSKE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |