C12H16FNO2 — CID 103887198
(3R,4S)-1-[(4-fluoro-2-methylphenyl)methyl]pyrrolidine-3,4-diol (PubChem CID 103887198) has the molecular formula C12H16FNO2 and a molecular weight of 225.26 g/mol. Its IUPAC name is (3R,4S)-1-[(4-fluoro-2-methylphenyl)methyl]pyrrolidine-3,4-diol.
| Compound Name | (3R,4S)-1-[(4-fluoro-2-methylphenyl)methyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 103887198 |
| Molecular Formula | C12H16FNO2 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | (3R,4S)-1-[(4-fluoro-2-methylphenyl)methyl]pyrrolidine-3,4-diol |
| SMILES | Cc1cc(F)ccc1CN1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C12H16FNO2/c1-8-4-10(13)3-2-9(8)5-14-6-11(15)12(16)7-14/h2-4,11-12,15-16H,5-7H2,1H3/t11-,12+ |
| InChIKey | GFRKOXZCHZGHRI-TXEJJXNPSA-N |
| XLogP | 0.67 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |