C22H22Cl2N4O2 — CID 10388797
2-(2,4-dichlorophenoxy)-N-(4-methyl-2-piperazin-1-ylquinolin-6-yl)acetamide (PubChem CID 10388797) has the molecular formula C22H22Cl2N4O2 and a molecular weight of 445.35 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(4-methyl-2-piperazin-1-ylquinolin-6-yl)acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(4-methyl-2-piperazin-1-ylquinolin-6-yl)acetamide |
|---|---|
| PubChem CID | 10388797 |
| Molecular Formula | C22H22Cl2N4O2 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(4-methyl-2-piperazin-1-ylquinolin-6-yl)acetamide |
| SMILES | Cc1cc(N2CCNCC2)nc2ccc(NC(=O)COc3ccc(Cl)cc3Cl)cc12 |
| InChI | InChI=1S/C22H22Cl2N4O2/c1-14-10-21(28-8-6-25-7-9-28)27-19-4-3-16(12-17(14)19)26-22(29)13-30-20-5-2-15(23)11-18(20)24/h2-5,10-12,25H,6-9,13H2,1H3,(H,26,29) |
| InChIKey | GALAIUNXQRYFIW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |