C23H23Cl2N3O2 — CID 3611477
2-(2,4-dichlorophenoxy)-N-(4-methyl-2-piperidin-1-ylquinolin-6-yl)acetamide (PubChem CID 3611477) has the molecular formula C23H23Cl2N3O2 and a molecular weight of 444.36 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(4-methyl-2-piperidin-1-ylquinolin-6-yl)acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(4-methyl-2-piperidin-1-ylquinolin-6-yl)acetamide |
|---|---|
| PubChem CID | 3611477 |
| Molecular Formula | C23H23Cl2N3O2 |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(4-methyl-2-piperidin-1-ylquinolin-6-yl)acetamide |
| SMILES | Cc1cc(N2CCCCC2)nc2ccc(NC(=O)COc3ccc(Cl)cc3Cl)cc12 |
| InChI | InChI=1S/C23H23Cl2N3O2/c1-15-11-22(28-9-3-2-4-10-28)27-20-7-6-17(13-18(15)20)26-23(29)14-30-21-8-5-16(24)12-19(21)25/h5-8,11-13H,2-4,9-10,14H2,1H3,(H,26,29) |
| InChIKey | NKJCLKBBZCIYSJ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |