C11H19N3OS — CID 103889222
N-(2-methyloxan-4-yl)-3-propan-2-yl-1,2,4-thiadiazol-5-amine (PubChem CID 103889222) has the molecular formula C11H19N3OS and a molecular weight of 241.36 g/mol. Its IUPAC name is N-(2-methyloxan-4-yl)-3-propan-2-yl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(2-methyloxan-4-yl)-3-propan-2-yl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 103889222 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | N-(2-methyloxan-4-yl)-3-propan-2-yl-1,2,4-thiadiazol-5-amine |
| SMILES | CC1CC(Nc2nc(C(C)C)ns2)CCO1 |
| InChI | InChI=1S/C11H19N3OS/c1-7(2)10-13-11(16-14-10)12-9-4-5-15-8(3)6-9/h7-9H,4-6H2,1-3H3,(H,12,13,14) |
| InChIKey | TYPBUSGVHBVPBP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |