C12H13BrF3N3O2 — CID 103889772
6-bromo-N-[2-(dimethylamino)-2-oxoethyl]-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide (PubChem CID 103889772) has the molecular formula C12H13BrF3N3O2 and a molecular weight of 368.15 g/mol. Its IUPAC name is 6-bromo-N-[2-(dimethylamino)-2-oxoethyl]-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide.
| Compound Name | 6-bromo-N-[2-(dimethylamino)-2-oxoethyl]-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 103889772 |
| Molecular Formula | C12H13BrF3N3O2 |
| Molecular Weight | 368.15 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | 6-bromo-N-[2-(dimethylamino)-2-oxoethyl]-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
| SMILES | CN(C)C(=O)CN(CC(F)(F)F)C(=O)c1cccc(Br)n1 |
| InChI | InChI=1S/C12H13BrF3N3O2/c1-18(2)10(20)6-19(7-12(14,15)16)11(21)8-4-3-5-9(13)17-8/h3-5H,6-7H2,1-2H3 |
| InChIKey | NWQCSFQYSYVARP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.15 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|