C13H13NO3S — CID 103890273
2,6-dihydroxy-N-(2-thiophen-3-ylethyl)benzamide (PubChem CID 103890273) has the molecular formula C13H13NO3S and a molecular weight of 263.32 g/mol. Its IUPAC name is 2,6-dihydroxy-N-(2-thiophen-3-ylethyl)benzamide.
| Compound Name | 2,6-dihydroxy-N-(2-thiophen-3-ylethyl)benzamide |
|---|---|
| PubChem CID | 103890273 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 2,6-dihydroxy-N-(2-thiophen-3-ylethyl)benzamide |
| SMILES | O=C(NCCc1ccsc1)c1c(O)cccc1O |
| InChI | InChI=1S/C13H13NO3S/c15-10-2-1-3-11(16)12(10)13(17)14-6-4-9-5-7-18-8-9/h1-3,5,7-8,15-16H,4,6H2,(H,14,17) |
| InChIKey | DYJYLTMZNAMHKL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |