C11H12N2OS — CID 110475807
N-(2-thiophen-3-ylethyl)-1H-pyrrole-2-carboxamide (PubChem CID 110475807) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is N-(2-thiophen-3-ylethyl)-1H-pyrrole-2-carboxamide.
| Compound Name | N-(2-thiophen-3-ylethyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 110475807 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | N-(2-thiophen-3-ylethyl)-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NCCc1ccsc1)c1ccc[nH]1 |
| InChI | InChI=1S/C11H12N2OS/c14-11(10-2-1-5-12-10)13-6-3-9-4-7-15-8-9/h1-2,4-5,7-8,12H,3,6H2,(H,13,14) |
| InChIKey | VATNSWHKWORAME-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |