C13H26N2O5S — CID 103891036
1-ethylsulfonyl-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]piperidine-4-carboxamide (PubChem CID 103891036) has the molecular formula C13H26N2O5S and a molecular weight of 322.43 g/mol. Its IUPAC name is 1-ethylsulfonyl-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-ethylsulfonyl-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 103891036 |
| Molecular Formula | C13H26N2O5S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 1-ethylsulfonyl-N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]piperidine-4-carboxamide |
| SMILES | CCC(CO)(CO)NC(=O)C1CCN(S(=O)(=O)CC)CC1 |
| InChI | InChI=1S/C13H26N2O5S/c1-3-13(9-16,10-17)14-12(18)11-5-7-15(8-6-11)21(19,20)4-2/h11,16-17H,3-10H2,1-2H3,(H,14,18) |
| InChIKey | FPQGKJGWMZFPNM-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |