C13H22F3NO3 — CID 106834436
N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 106834436) has the molecular formula C13H22F3NO3 and a molecular weight of 297.32 g/mol. Its IUPAC name is N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 106834436 |
| Molecular Formula | C13H22F3NO3 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | CCC(CO)(CO)NC(=O)C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H22F3NO3/c1-2-12(7-18,8-19)17-11(20)9-3-5-10(6-4-9)13(14,15)16/h9-10,18-19H,2-8H2,1H3,(H,17,20) |
| InChIKey | WIMOJBUPARMGLW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |