C31H52N2 — CID 10389182
(4E,18E)-1,15-diazatricyclo[26.3.1.111,15]tritriaconta-4,11,18,28-tetraene (PubChem CID 10389182) has the molecular formula C31H52N2 and a molecular weight of 452.77 g/mol. Its IUPAC name is (4E,18E)-1,15-diazatricyclo[26.3.1.111,15]tritriaconta-4,11,18,28-tetraene.
| Compound Name | (4E,18E)-1,15-diazatricyclo[26.3.1.111,15]tritriaconta-4,11,18,28-tetraene |
|---|---|
| PubChem CID | 10389182 |
| Molecular Formula | C31H52N2 |
| Molecular Weight | 452.77 g/mol |
| Exact Mass | 452.41 |
| IUPAC Name | (4E,18E)-1,15-diazatricyclo[26.3.1.111,15]tritriaconta-4,11,18,28-tetraene |
| SMILES | C1=C2CCCCC/C=C\CCN3CCC=C(CCCCCCCC/C=C\CCN(CC1)C2)C3 |
| InChI | InChI=1S/C31H52N2/c1-2-4-8-12-16-24-32-26-19-23-31(29-32)21-15-11-7-5-9-13-17-25-33-27-18-22-30(28-33)20-14-10-6-3-1/h8-9,12-13,22-23H,1-7,10-11,14-21,24-29H2/b12-8-,13-9- |
| InChIKey | FOMNKSMMWYZEFH-JMVBYTIWSA-N |
| XLogP | 8.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.77 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|