C12H13F2N3O2S — CID 103894690
4-(difluoromethylsulfonyl)-N-[1-(1H-pyrazol-4-yl)ethyl]aniline (PubChem CID 103894690) has the molecular formula C12H13F2N3O2S and a molecular weight of 301.32 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-[1-(1H-pyrazol-4-yl)ethyl]aniline.
| Compound Name | 4-(difluoromethylsulfonyl)-N-[1-(1H-pyrazol-4-yl)ethyl]aniline |
|---|---|
| PubChem CID | 103894690 |
| Molecular Formula | C12H13F2N3O2S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-[1-(1H-pyrazol-4-yl)ethyl]aniline |
| SMILES | CC(Nc1ccc(S(=O)(=O)C(F)F)cc1)c1cn[nH]c1 |
| InChI | InChI=1S/C12H13F2N3O2S/c1-8(9-6-15-16-7-9)17-10-2-4-11(5-3-10)20(18,19)12(13)14/h2-8,12,17H,1H3,(H,15,16) |
| InChIKey | DEIDSFGZEUEJNK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |