C30H25ClN2O5 — CID 1038956
(6S,9R)-6-(6-chloro-4-oxochromen-3-yl)-9-(3,4-dimethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 1038956) has the molecular formula C30H25ClN2O5 and a molecular weight of 528.99 g/mol. Its IUPAC name is (6S,9R)-6-(6-chloro-4-oxochromen-3-yl)-9-(3,4-dimethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6S,9R)-6-(6-chloro-4-oxochromen-3-yl)-9-(3,4-dimethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 1038956 |
| Molecular Formula | C30H25ClN2O5 |
| Molecular Weight | 528.99 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | (6S,9R)-6-(6-chloro-4-oxochromen-3-yl)-9-(3,4-dimethoxyphenyl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | COc1ccc([C@H]2CC(=O)C3=C(C2)Nc2ccccc2N[C@@H]3c2coc3ccc(Cl)cc3c2=O)cc1OC |
| InChI | InChI=1S/C30H25ClN2O5/c1-36-26-9-7-16(13-27(26)37-2)17-11-23-28(24(34)12-17)29(33-22-6-4-3-5-21(22)32-23)20-15-38-25-10-8-18(31)14-19(25)30(20)35/h3-10,13-15,17,29,32-33H,11-12H2,1-2H3/t17-,29-/m1/s1 |
| InChIKey | LWJVUWUMGLWPQZ-CQGGRAHPSA-N |
| XLogP | 6.44 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.99 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |