C29H23ClN2O3 — CID 40733124
(6S,9R)-9-(2-chlorophenyl)-6-(6-methyl-4-oxochromen-3-yl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 40733124) has the molecular formula C29H23ClN2O3 and a molecular weight of 482.97 g/mol. Its IUPAC name is (6S,9R)-9-(2-chlorophenyl)-6-(6-methyl-4-oxochromen-3-yl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6S,9R)-9-(2-chlorophenyl)-6-(6-methyl-4-oxochromen-3-yl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 40733124 |
| Molecular Formula | C29H23ClN2O3 |
| Molecular Weight | 482.97 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | (6S,9R)-9-(2-chlorophenyl)-6-(6-methyl-4-oxochromen-3-yl)-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | Cc1ccc2occ([C@H]3Nc4ccccc4NC4=C3C(=O)C[C@H](c3ccccc3Cl)C4)c(=O)c2c1 |
| InChI | InChI=1S/C29H23ClN2O3/c1-16-10-11-26-19(12-16)29(34)20(15-35-26)28-27-24(31-22-8-4-5-9-23(22)32-28)13-17(14-25(27)33)18-6-2-3-7-21(18)30/h2-12,15,17,28,31-32H,13-14H2,1H3/t17-,28-/m1/s1 |
| InChIKey | GTIJUYRURIFXCS-JYRCXFKTSA-N |
| XLogP | 6.73 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.97 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |