C10H10BrN3O3S — CID 103895771
N-(6-bromo-3-pyridinyl)-1-(5-methyl-1,2-oxazol-3-yl)methanesulfonamide (PubChem CID 103895771) has the molecular formula C10H10BrN3O3S and a molecular weight of 332.18 g/mol. Its IUPAC name is N-(6-bromo-3-pyridinyl)-1-(5-methyl-1,2-oxazol-3-yl)methanesulfonamide.
| Compound Name | N-(6-bromo-3-pyridinyl)-1-(5-methyl-1,2-oxazol-3-yl)methanesulfonamide |
|---|---|
| PubChem CID | 103895771 |
| Molecular Formula | C10H10BrN3O3S |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 330.96 |
| IUPAC Name | N-(6-bromo-3-pyridinyl)-1-(5-methyl-1,2-oxazol-3-yl)methanesulfonamide |
| SMILES | Cc1cc(CS(=O)(=O)Nc2ccc(Br)nc2)no1 |
| InChI | InChI=1S/C10H10BrN3O3S/c1-7-4-9(13-17-7)6-18(15,16)14-8-2-3-10(11)12-5-8/h2-5,14H,6H2,1H3 |
| InChIKey | URDKDGVBXQHLKZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|