C14H19ClN2O — CID 103896033
4-chloro-2-[(5-hydroxy-2,2-dimethylpentyl)amino]benzonitrile (PubChem CID 103896033) has the molecular formula C14H19ClN2O and a molecular weight of 266.77 g/mol. Its IUPAC name is 4-chloro-2-[(5-hydroxy-2,2-dimethylpentyl)amino]benzonitrile.
| Compound Name | 4-chloro-2-[(5-hydroxy-2,2-dimethylpentyl)amino]benzonitrile |
|---|---|
| PubChem CID | 103896033 |
| Molecular Formula | C14H19ClN2O |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 4-chloro-2-[(5-hydroxy-2,2-dimethylpentyl)amino]benzonitrile |
| SMILES | CC(C)(CCCO)CNc1cc(Cl)ccc1C#N |
| InChI | InChI=1S/C14H19ClN2O/c1-14(2,6-3-7-18)10-17-13-8-12(15)5-4-11(13)9-16/h4-5,8,17-18H,3,6-7,10H2,1-2H3 |
| InChIKey | IKUHUOHLBYJGMA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |