About 2-bromo-6-[(5-hydroxy-2,2-dimethylpentyl)amino]benzonitrile
2-bromo-6-[(5-hydroxy-2,2-dimethylpentyl)amino]benzonitrile (PubChem CID 106145283) has the molecular formula C14H19BrN2O
and a molecular weight of 311.22 g/mol. Its IUPAC name is 2-bromo-6-[(5-hydroxy-2,2-dimethylpentyl)amino]benzonitrile.
Molecular Properties
| Compound Name | 2-bromo-6-[(5-hydroxy-2,2-dimethylpentyl)amino]benzonitrile |
| PubChem CID | 106145283 |
| Molecular Formula | C14H19BrN2O |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2-bromo-6-[(5-hydroxy-2,2-dimethylpentyl)amino]benzonitrile |
| SMILES | CC(C)(CCCO)CNc1cccc(Br)c1C#N |
| InChI | InChI=1S/C14H19BrN2O/c1-14(2,7-4-8-18)10-17-13-6-3-5-12(15)11(13)9-16/h3,5-6,17-18H,4,7-8,10H2,1-2H3 |
| InChIKey | IRGPLFXKZQUZCF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-bromo-6-[(5-hydroxy-2,2-dimethylpentyl)amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-[(5-hydroxy-2,2-dimethylpentyl)amino]benzonitrile?
The IUPAC name of 2-bromo-6-[(5-hydroxy-2,2-dimethylpentyl)amino]benzonitrile (CID 106145283) is 2-bromo-6-[(5-hydroxy-2,2-dimethylpentyl)amino]benzonitrile.
What is the SMILES notation for 2-bromo-6-[(5-hydroxy-2,2-dimethylpentyl)amino]benzonitrile?
The canonical SMILES for 2-bromo-6-[(5-hydroxy-2,2-dimethylpentyl)amino]benzonitrile is CC(C)(CCCO)CNc1cccc(Br)c1C#N.
What is the InChIKey of 2-bromo-6-[(5-hydroxy-2,2-dimethylpentyl)amino]benzonitrile?
The InChIKey is IRGPLFXKZQUZCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19BrN2O/c1-14(2,7-4-8-18)10-17-13-6-3-5-12(15)11(13)9-16/h3,5-6,17-18H,4,7-8,10H2,1-2H3.
What are the key properties of 2-bromo-6-[(5-hydroxy-2,2-dimethylpentyl)amino]benzonitrile?
2-bromo-6-[(5-hydroxy-2,2-dimethylpentyl)amino]benzonitrile has a molecular weight of 311.22 g/mol, XLogP of 3.53, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-[(5-hydroxy-2,2-dimethylpentyl)amino]benzonitrile is sourced from PubChem (CID 106145283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).