C14H19BrN2O — CID 114884515
2-bromo-6-[(2-hydroxy-2,4-dimethylpentyl)amino]benzonitrile (PubChem CID 114884515) has the molecular formula C14H19BrN2O and a molecular weight of 311.22 g/mol. Its IUPAC name is 2-bromo-6-[(2-hydroxy-2,4-dimethylpentyl)amino]benzonitrile.
| Compound Name | 2-bromo-6-[(2-hydroxy-2,4-dimethylpentyl)amino]benzonitrile |
|---|---|
| PubChem CID | 114884515 |
| Molecular Formula | C14H19BrN2O |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2-bromo-6-[(2-hydroxy-2,4-dimethylpentyl)amino]benzonitrile |
| SMILES | CC(C)CC(C)(O)CNc1cccc(Br)c1C#N |
| InChI | InChI=1S/C14H19BrN2O/c1-10(2)7-14(3,18)9-17-13-6-4-5-12(15)11(13)8-16/h4-6,10,17-18H,7,9H2,1-3H3 |
| InChIKey | BWXZRJGLVILSNK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |