C16H23BrN2 — CID 114881217
2-bromo-6-(2,2-dimethylheptylamino)benzonitrile (PubChem CID 114881217) has the molecular formula C16H23BrN2 and a molecular weight of 323.28 g/mol. Its IUPAC name is 2-bromo-6-(2,2-dimethylheptylamino)benzonitrile.
| Compound Name | 2-bromo-6-(2,2-dimethylheptylamino)benzonitrile |
|---|---|
| PubChem CID | 114881217 |
| Molecular Formula | C16H23BrN2 |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 2-bromo-6-(2,2-dimethylheptylamino)benzonitrile |
| SMILES | CCCCCC(C)(C)CNc1cccc(Br)c1C#N |
| InChI | InChI=1S/C16H23BrN2/c1-4-5-6-10-16(2,3)12-19-15-9-7-8-14(17)13(15)11-18/h7-9,19H,4-6,10,12H2,1-3H3 |
| InChIKey | QGLMYIKCDFNWES-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|