C12H15N5O2 — CID 103896434
N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 103896434) has the molecular formula C12H15N5O2 and a molecular weight of 261.28 g/mol. Its IUPAC name is N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 103896434 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | CCc1nn(C)cc1CNC(=O)c1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C12H15N5O2/c1-3-9-8(7-17(2)16-9)6-13-12(19)10-4-5-11(18)15-14-10/h4-5,7H,3,6H2,1-2H3,(H,13,19)(H,15,18) |
| InChIKey | DGZLETJGQPUARU-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |