C16H18N4O — CID 115888739
N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1H-indole-3-carboxamide (PubChem CID 115888739) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1H-indole-3-carboxamide.
| Compound Name | N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 115888739 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1H-indole-3-carboxamide |
| SMILES | CCc1nn(C)cc1CNC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H18N4O/c1-3-14-11(10-20(2)19-14)8-18-16(21)13-9-17-15-7-5-4-6-12(13)15/h4-7,9-10,17H,3,8H2,1-2H3,(H,18,21) |
| InChIKey | YWOOBAKJVYQGPE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |