C13H18BrNO4S — CID 103896516
5-bromo-2-methoxy-N-(3-methyloxan-3-yl)benzenesulfonamide (PubChem CID 103896516) has the molecular formula C13H18BrNO4S and a molecular weight of 364.26 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-(3-methyloxan-3-yl)benzenesulfonamide.
| Compound Name | 5-bromo-2-methoxy-N-(3-methyloxan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 103896516 |
| Molecular Formula | C13H18BrNO4S |
| Molecular Weight | 364.26 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 5-bromo-2-methoxy-N-(3-methyloxan-3-yl)benzenesulfonamide |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)NC1(C)CCCOC1 |
| InChI | InChI=1S/C13H18BrNO4S/c1-13(6-3-7-19-9-13)15-20(16,17)12-8-10(14)4-5-11(12)18-2/h4-5,8,15H,3,6-7,9H2,1-2H3 |
| InChIKey | HXFBOTSWQDWIJV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |