C12H16BrNO5S — CID 103848139
5-bromo-N-[(3-hydroxyoxolan-3-yl)methyl]-2-methoxybenzenesulfonamide (PubChem CID 103848139) has the molecular formula C12H16BrNO5S and a molecular weight of 366.23 g/mol. Its IUPAC name is 5-bromo-N-[(3-hydroxyoxolan-3-yl)methyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-bromo-N-[(3-hydroxyoxolan-3-yl)methyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 103848139 |
| Molecular Formula | C12H16BrNO5S |
| Molecular Weight | 366.23 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | 5-bromo-N-[(3-hydroxyoxolan-3-yl)methyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(Br)cc1S(=O)(=O)NCC1(O)CCOC1 |
| InChI | InChI=1S/C12H16BrNO5S/c1-18-10-3-2-9(13)6-11(10)20(16,17)14-7-12(15)4-5-19-8-12/h2-3,6,14-15H,4-5,7-8H2,1H3 |
| InChIKey | PHNNRZNKVCVLSM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |