C11H15NO6S2 — CID 103848035
methyl 3-[(3-hydroxyoxolan-3-yl)methylsulfamoyl]thiophene-2-carboxylate (PubChem CID 103848035) has the molecular formula C11H15NO6S2 and a molecular weight of 321.38 g/mol. Its IUPAC name is methyl 3-[(3-hydroxyoxolan-3-yl)methylsulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(3-hydroxyoxolan-3-yl)methylsulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 103848035 |
| Molecular Formula | C11H15NO6S2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | methyl 3-[(3-hydroxyoxolan-3-yl)methylsulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)NCC1(O)CCOC1 |
| InChI | InChI=1S/C11H15NO6S2/c1-17-10(13)9-8(2-5-19-9)20(15,16)12-6-11(14)3-4-18-7-11/h2,5,12,14H,3-4,6-7H2,1H3 |
| InChIKey | MYSYBDQNSYTUKE-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |